CAS 111974-39-1

Ethyl 4-ethoxy-6-methyl-3-pyridinecarboxylate

Description:

Ethyl 4-ethoxy-6-methyl-3-pyridinecarboxylate, with the CAS number 111974-39-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the ethoxy group and the methyl substituent on the pyridine ring enhances its lipophilicity, making it more soluble in organic solvents. Ethyl 4-ethoxy-6-methyl-3-pyridinecarboxylate may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, this compound is of interest in organic synthesis and may have applications in medicinal chemistry or related fields.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-4-14-10-6-8(3)12-7-9(10)11(13)15-5-2/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=XWGXVPBKJNOPGR-UHFFFAOYSA-N

SMILES: O(CC)C=1C(C(OCC)=O)=CN=C(C)C1

Synonyms:

• 3-Pyridinecarboxylic acid, 4-ethoxy-6-methyl-, ethyl ester
• Ethyl 4-ethoxy-6-methyl-3-pyridinecarboxylate