
CAS 111982-47-9
:Cyclopentanol, 1-[(2-fluorophenyl)(methylimino)methyl]-, hydrochloride (1:1)
Description:
Cyclopentanol, 1-[(2-fluorophenyl)(methylimino)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopentanol moiety and a substituted imine group. The presence of the 2-fluorophenyl group introduces a fluorine atom, which can influence the compound's reactivity and polarity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in various fields, including pharmaceuticals. The compound may exhibit properties such as moderate to high boiling and melting points, depending on the specific interactions between its functional groups. Additionally, the presence of the hydroxyl group in cyclopentanol suggests potential for hydrogen bonding, which can affect its solubility and stability. Overall, this compound's characteristics make it of interest for further research, particularly in medicinal chemistry, where its structural features may contribute to biological activity. However, specific physical and chemical properties would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C13H16FNO·ClH
InChI:InChI=1S/C13H16FNO.ClH/c1-15-12(13(16)8-4-5-9-13)10-6-2-3-7-11(10)14;/h2-3,6-7,16H,4-5,8-9H2,1H3;1H
InChI key:InChIKey=FHRLNGYNNIFNJC-UHFFFAOYSA-N
SMILES:C(=NC)(C1=C(F)C=CC=C1)C2(O)CCCC2.Cl
Synonyms:- Cyclopentanol, 1-[(2-fluorophenyl)(methylimino)methyl]-, hydrochloride
- Cyclopentanol, 1-[(2-fluorophenyl)(methylimino)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[(2-Fluorophenyl)(methylimino)methyl]-cyclopentanol Hydrochloride
CAS:Controlled ProductFormula:C13H16FNO•(HCl)Color and Shape:NeatMolecular weight:257.09827
