
CAS 111985-13-8
:Poly(tartronic acid)
Description:
Poly(tartronic acid) is a synthetic polymer derived from tartronic acid, which is a dicarboxylic acid. This polymer is characterized by its ability to form hydrogels, making it useful in various applications, particularly in biomedical fields such as drug delivery and tissue engineering. Poly(tartronic acid) exhibits good biocompatibility and biodegradability, which are essential properties for materials intended for use in biological systems. The polymer's structure allows for the incorporation of functional groups that can enhance its interaction with biological molecules, facilitating targeted delivery of therapeutics. Additionally, it can be processed into various forms, including films and scaffolds, providing versatility in its applications. The presence of carboxylic acid groups contributes to its hydrophilicity, influencing its solubility and swelling behavior in aqueous environments. Overall, poly(tartronic acid) is a promising material in the development of advanced biomaterials due to its unique chemical properties and potential for customization.
Formula:(C3H4O5)x
InChI:InChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8)
InChI key:InChIKey=ROBFUDYVXSDBQM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)O
Synonyms:- Propanedioic acid, hydroxy-, homopolymer
- Poly(tartronic acid)
- Poly(hydroxymalonic acid)
- Propanedioic acid, 2-hydroxy-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
