CAS 111991-15-2: 2-[2-(Trifluoromethyl)phenyl]oxirane
Description:2-[2-(Trifluoromethyl)phenyl]oxirane, also known by its CAS number 111991-15-2, is an organic compound characterized by the presence of an epoxide functional group and a trifluoromethyl-substituted phenyl ring. The epoxide structure consists of a three-membered cyclic ether, which imparts significant reactivity, particularly in nucleophilic addition reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it a valuable building block in medicinal chemistry and materials science. This compound is typically colorless to pale yellow and may have a distinct odor. Its reactivity allows it to participate in various chemical transformations, making it useful in the synthesis of more complex molecules. Additionally, the presence of fluorine atoms can affect the compound's stability and solubility in different solvents. Safety precautions should be taken when handling this compound due to its potential reactivity and the toxicity associated with fluorinated compounds.
Formula:C9H7F3O
InChI:InChI=1S/C9H7F3O/c10-9(11,12)7-4-2-1-3-6(7)8-5-13-8/h1-4,8H,5H2
InChI key:InChIKey=OHLNNWAJIJAXDX-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1C=CC=CC1C2OC2
- Synonyms:
- Oxirane, 2-[2-(trifluoromethyl)phenyl]-
- 2-[2-(Trifluoromethyl)phenyl]oxirane
- Oxirane, [2-(trifluoromethyl)phenyl]-
- 2-Trifluoromethylphenyloxirane
- 2-(2-Trifluoromethylphenyl)oxirane
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-[2-(trifluoromethyl)phenyl]oxirane REF: IN-DA009U6LCAS: 111991-15-2 | 97% | 194.00 €~565.00 € | Tue 04 Mar 25 |
![]() | 2-[2-(trifluoromethyl)phenyl]oxirane REF: 10-F665118CAS: 111991-15-2 | 98% | To inquire | Wed 12 Mar 25 |
![]() | 2-[2-(Trifluoromethyl)Phenyl]Oxirane REF: 3D-FT82957CAS: 111991-15-2 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-[2-(trifluoromethyl)phenyl]oxirane
Ref: IN-DA009U6L
1g | 201.00 € | ||
5g | 565.00 € | ||
500mg | 194.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-[2-(trifluoromethyl)phenyl]oxirane
- Ethers
- Fluorinated Compounds
- Oxirane
- Ether and Impurities
- See more categories
- Oxirane and Impurities
Ref: 10-F665118
1g | To inquire | ||
5g | To inquire | ||
500mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-[2-(Trifluoromethyl)Phenyl]Oxirane
Ref: 3D-FT82957
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |