CAS 111991-16-3
:2-(4-Fluoro-2-methylphenyl)oxirane
Description:
2-(4-Fluoro-2-methylphenyl)oxirane, with the CAS number 111991-16-3, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a fluorinated aromatic ring, specifically a para-fluoro substitution on a 2-methylphenyl group, contributing to its unique chemical properties. The presence of the oxirane ring makes it reactive, particularly towards nucleophiles, allowing for various chemical transformations. Its fluorine atom can influence the compound's polarity, stability, and reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceuticals. The compound's structure suggests it may exhibit interesting biological activities, although specific biological data may vary. Additionally, its physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, 2-(4-Fluoro-2-methylphenyl)oxirane is a valuable compound for research and applications in various chemical fields.
Formula:C9H9FO
InChI:InChI=1S/C9H9FO/c1-6-4-7(10)2-3-8(6)9-5-11-9/h2-4,9H,5H2,1H3
InChI key:InChIKey=WMKBHLOZAVREOH-UHFFFAOYSA-N
SMILES:CC1=C(C2CO2)C=CC(F)=C1
Synonyms:- 2-(4-Fluoro-2-methylphenyl)oxirane
- Oxirane, (4-fluoro-2-methylphenyl)-
- Oxirane, 2-(4-fluoro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.