
CAS 111992-18-8
:2-(5-Amino-2,4-dichlorophenyl)-4-(difluoromethyl)-2,4-dihydro-5-methyl-3H-1,2,4-triazol-3-one
Description:
2-(5-Amino-2,4-dichlorophenyl)-4-(difluoromethyl)-2,4-dihydro-5-methyl-3H-1,2,4-triazol-3-one, with CAS number 111992-18-8, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This substance features a complex structure characterized by the presence of a triazole ring, an amino group, and multiple halogen substituents, specifically dichloro and difluoromethyl groups. These functional groups contribute to its potential biological activity and chemical reactivity. The compound is typically synthesized through multi-step organic reactions, and its properties may include moderate solubility in organic solvents and stability under standard laboratory conditions. It may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. However, specific applications and safety profiles would depend on further studies and regulatory assessments. As with any chemical, proper handling and safety precautions are essential when working with this compound.
Formula:C10H8Cl2F2N4O
InChI:InChI=1S/C10H8Cl2F2N4O/c1-4-16-18(10(19)17(4)9(13)14)8-3-7(15)5(11)2-6(8)12/h2-3,9H,15H2,1H3
InChI key:InChIKey=FSLSBGAOONZXNQ-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C)N1C(F)F)C2=C(Cl)C=C(Cl)C(N)=C2
Synonyms:- 3H-1,2,4-Triazol-3-one, 2-(5-amino-2,4-dichlorophenyl)-4-(difluoromethyl)-2,4-dihydro-5-methyl-
- 1-(5-Amino-2,4-dichlorophenyl)-4,5-dihydro-4-difluoromethyl-3-methyl-1,2,4-triazol-5(1H)-one
- 2-(5-Amino-2,4-dichlorophenyl)-4-(difluoromethyl)-2,4-dihydro-5-methyl-3H-1,2,4-triazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

