CAS 112-98-1
:5,8,11,14,17-Pentaoxaheneicosane
Description:
5,8,11,14,17-Pentaoxaheneicosane, with the CAS number 112-98-1, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This molecule consists of a 20-carbon backbone with five ether (-O-) groups interspersed along the chain, which contributes to its unique properties. The presence of these ether linkages enhances its solubility in polar solvents compared to typical hydrocarbons. It is generally a colorless, viscous liquid at room temperature and exhibits low volatility. The compound is of interest in various applications, including as a surfactant, lubricant, or in the formulation of specialty chemicals. Its structure allows for potential use in materials science, particularly in the development of polymers or coatings that require flexibility and thermal stability. Additionally, due to its ether groups, it may exhibit interesting interactions with biological systems, making it a candidate for further research in biochemistry and pharmacology. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C16H34O5
InChI:InChI=1S/C16H34O5/c1-3-5-7-17-9-11-19-13-15-21-16-14-20-12-10-18-8-6-4-2/h3-16H2,1-2H3
InChI key:InChIKey=MQGIBEAIDUOVOH-UHFFFAOYSA-N
SMILES:O(CCOCCOCCCC)CCOCCOCCCC
Synonyms:- Tetraethylene glycol dibutyl ether
- Pentaether
- 5,8,11,14,17-Pentaoxaheneicosane
- 5,8,11,14,17-Pentaoxauneicosane
- Ether, bis[2-(2-butoxyethoxy)ethyl]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
