CAS 112009-62-8

(αR)-α-(Azidomethyl)benzeneethanol

Description:

(αR)-α-(Azidomethyl)benzeneethanol, with the CAS number 112009-62-8, is a chemical compound characterized by the presence of an azide functional group (-N3) and a benzene ring, which contributes to its aromatic properties. This compound features a chiral center, indicated by the (αR) designation, suggesting that it exists in a specific stereoisomeric form. The azidomethyl group introduces unique reactivity, making it a potential candidate for various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the hydroxyl (-OH) group in the benzeneethanol structure enhances its solubility in polar solvents and may influence its biological activity. Additionally, the azide group can participate in click chemistry reactions, allowing for the formation of diverse chemical entities. Overall, (αR)-α-(Azidomethyl)benzeneethanol is a versatile compound with potential applications in research and development, particularly in the fields of pharmaceuticals and materials science.

Formula: C₉H₁₁N₃O

InChI: InChI=1S/C9H11N3O/c10-12-11-7-9(13)6-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2/t9-/m1/s1

InChI key: InChIKey=RDZHIJATXQDZPO-SECBINFHSA-N

SMILES: C([C@H](CN=[N+]=[N-])O)C1=CC=CC=C1

Synonyms:

• (αR)-α-(Azidomethyl)benzeneethanol
• (R)-1-Azido-2-hydroxy-3-phenylpropane
• Benzeneethanol, α-(azidomethyl)-, (αR)-
• (2R)-1-Azido-3-phenylpropan-2-ol
• Benzeneethanol, α-(azidomethyl)-, (R)-