CAS 1120284-77-6
:2-[[5-(1-Methylethyl)-3-isoxazolyl]methoxy]ethanamine
Description:
2-[[5-(1-Methylethyl)-3-isoxazolyl]methoxy]ethanamine, identified by its CAS number 1120284-77-6, is a chemical compound characterized by its unique structural features, including an isoxazole ring and an ethylamine moiety. The presence of the isoxazole ring contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The compound's methoxy group enhances its solubility and reactivity, making it suitable for various applications in medicinal chemistry. Additionally, the branched alkyl group (1-methylethyl) may influence its lipophilicity and interaction with biological targets. Overall, this compound's characteristics suggest potential utility in drug development, particularly in areas requiring modulation of biological pathways. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies to fully understand its potential applications and safety profile.
Formula:C9H16N2O2
InChI:InChI=1S/C9H16N2O2/c1-7(2)9-5-8(11-13-9)6-12-4-3-10/h5,7H,3-4,6,10H2,1-2H3
InChI key:InChIKey=YKLADHIJCJEGIQ-UHFFFAOYSA-N
SMILES:C(OCCN)C=1C=C(C(C)C)ON1
Synonyms:- Ethanamine, 2-[[5-(1-methylethyl)-3-isoxazolyl]methoxy]-
- 2-[[5-(1-Methylethyl)-3-isoxazolyl]methoxy]ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.