CAS 112029-98-8

4-Hydroxymethyl-1-methylpyrazole

Description:

4-Hydroxymethyl-1-methylpyrazole, identified by its CAS number 112029-98-8, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the pyrazole ring, contributing to its unique reactivity and properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to act as a building block in organic synthesis. Its stability and reactivity can be influenced by the functional groups present, making it a versatile intermediate in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₈N₂O

InChI: InChI=1/C5H8N2O/c1-7-3-5(4-8)2-6-7/h2-3,8H,4H2,1H3

SMILES: Cn1cc(cn1)CO

Synonyms:

• 1-Methyl-1H-pyrazole-4-methanol
• (1-methyl-1H-pyrazol-4-yl)methanol

4-Hydroxymethyl-1-Methylpyrazole

CAS: 112029-98-8

Formula: C₅H₈N₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 112.1298

Ref: IN-DA008U8L

4-Hydroxymethyl-1-Methylpyrazole

CAS: 112029-98-8

4-Hydroxymethyl-1-Methylpyrazole

Purity: 97%

Molecular weight: 112.13g/mol

Ref: 54-OR1011569

(1-Methyl-1H-pyrazol-4-yl)methanol

CAS: 112029-98-8

Formula: C₅H₈N₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 112.132

Ref: 10-F036306