CymitQuimica logo

CAS 112037-78-2

:

1,2,3,4-Tetrahydro-1-(trifluoromethyl)-ß-carboline

Description:
1,2,3,4-Tetrahydro-1-(trifluoromethyl)-β-carboline is a chemical compound belonging to the β-carboline family, which is characterized by a fused bicyclic structure containing a pyridine and a pyrrole ring. This specific compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the trifluoromethyl group can enhance the compound's stability and reactivity, making it of interest in medicinal chemistry and drug development. β-Carbolines are known for their diverse pharmacological activities, including neuroprotective and psychoactive effects, which may also apply to this compound. Its synthesis often involves multi-step organic reactions, and it may be studied for its potential applications in treating neurological disorders or as a building block in the development of more complex molecules. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C12H11F3N2
InChI:InChI=1/C12H11F3N2/c13-12(14,15)11-10-8(5-6-16-11)7-3-1-2-4-9(7)17-10/h1-4,11,16-17H,5-6H2
SMILES:c1ccc2c(c1)c1CCNC(c1[nH]2)C(F)(F)F
Synonyms:
  • 1-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-beta-carboline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.