CAS 112055-76-2
:Decylplastoquinone
Description:
Decylplastoquinone is a synthetic compound that belongs to the class of plastoquinones, which are important in photosynthetic electron transport. It features a long hydrophobic decyl chain, which enhances its solubility in lipid environments, making it relevant in biological membranes. The compound is characterized by its quinone functional group, which allows it to participate in redox reactions, acting as an electron carrier. Decylplastoquinone is often studied for its potential roles in bioenergetics and its interactions with various biomolecules. Its structure contributes to its ability to influence membrane dynamics and cellular processes, particularly in photosynthetic organisms. Additionally, it may exhibit antioxidant properties, which can be beneficial in mitigating oxidative stress in biological systems. Overall, Decylplastoquinone serves as a valuable model for understanding the function of quinones in biological systems and their applications in biochemistry and molecular biology.
Formula:C18H28O2
InChI:InChI=1S/C18H28O2/c1-4-5-6-7-8-9-10-11-12-16-13-17(19)14(2)15(3)18(16)20/h13H,4-12H2,1-3H3
InChI key:InChIKey=APNQQQRDLMWNLM-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)C=1C(=O)C(C)=C(C)C(=O)C1
Synonyms:- 2,3-Dimethyl-6-decyl-1,4-benzoquinone
- 2,5-Cyclohexadiene-1,4-dione, 5-decyl-2,3-dimethyl-
- 5-Decyl-2,3-dimethyl-2,5-cyclohexadiene-1,4-dione
- Decylplastoquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
