CAS 112055-80-8

4-[(2S)-2-amino-3-hydroxy-3-oxo-propyl]pyridine-2-carboxylic acid

Description:

4-[(2S)-2-amino-3-hydroxy-3-oxo-propyl]pyridine-2-carboxylic acid, with the CAS number 112055-80-8, is a chemical compound characterized by its pyridine ring structure, which is substituted with a carboxylic acid group and an amino acid side chain. This compound features a chiral center, indicating that it can exist in different stereoisomeric forms, specifically the (2S) configuration. The presence of the hydroxyl and carbonyl groups in the side chain contributes to its potential as a bioactive molecule, possibly influencing its solubility and reactivity. The compound may exhibit properties typical of both amino acids and pyridine derivatives, such as potential interactions with biological systems, making it of interest in pharmaceutical and biochemical research. Its structural features suggest it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Overall, this compound's unique combination of functional groups and its heterocyclic nature make it a subject of interest in various fields, including medicinal chemistry and drug design.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1/C9H10N2O4/c10-6(8(12)13)3-5-1-2-11-7(4-5)9(14)15/h1-2,4,6H,3,10H2,(H,12,13)(H,14,15)/t6-/m0/s1

SMILES: c1cnc(cc1C[C@@H](C(=O)O)N)C(=O)O

Synonyms:

• 4-[(2S)-2-Amino-2-carboxyethyl]pyridine-2-carboxylic acid
• 4-pyridinepropanoic acid, α-amino-2-carboxy-, (alphaS)-