CAS 112058-90-9
:4-(4-Fluorophenyl)-3-(4-hydroxy-3-methoxyphenoxymethyl)piperidine
Description:
4-(4-Fluorophenyl)-3-(4-hydroxy-3-methoxyphenoxymethyl)piperidine, with CAS number 112058-90-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with various functional groups. The presence of a fluorophenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the influence of fluorine on biological activity and lipophilicity. The hydroxy and methoxy groups contribute to the compound's polarity and solubility, which can affect its pharmacokinetics and bioavailability. This compound may exhibit specific interactions with biological targets, making it of interest in drug discovery and development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods. Overall, the unique combination of functional groups in this compound may lead to interesting biological activities, warranting further investigation in the context of therapeutic applications.
Formula:C19H22FNO3
InChI:InChI=1/C19H22FNO3/c1-23-19-10-16(6-7-18(19)22)24-12-14-11-21-9-8-17(14)13-2-4-15(20)5-3-13/h2-7,10,14,17,21-22H,8-9,11-12H2,1H3
SMILES:COc1cc(ccc1O)OCC1CNCCC1c1ccc(cc1)F
Synonyms:- (-)-Trans-4-[4-(4'-Fluorophenyl)-3-Piperidinylmethoxy]-2-Methoxyphenol, Hydrochloride
- (-)-trans-4-[4-(4Fluorophenyl)-3-piperidinylmethoxy]-2-methoxyphenol,HCl
- (-)-trans-4-[4-(4Fluorophenyl)-3-piperidinylmethoxy]-2-methoxyphenol
- Brl 36610
- Paroxetine metabolite B
- 4-[[(3S,4R)-4-(4-Fluorophenyl)piperidin-3-yl]methoxy]-2-methoxyphenol
- 4-{[4-(4-Fluorophenyl)Piperidin-3-Yl]Methoxy}-2-Methoxyphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(-)-trans-4-[4-(4'-Fluorophenyl)-3-piperidinylmethoxy]-2-methoxyphenol (Paroxetine metabolite)
CAS:Controlled ProductFormula:C19H22FNO3Color and Shape:NeatMolecular weight:331.38


