CymitQuimica logo

CAS 112078-70-3

:

10-hydroxy-5,9-dimethoxy-2H-pyrano[2,3,4-kl]xanthen-2-one

Description:
10-Hydroxy-5,9-dimethoxy-2H-pyrano[2,3,4-kl]xanthen-2-one, with the CAS number 112078-70-3, is a synthetic organic compound belonging to the class of xanthenes. This compound features a complex polycyclic structure characterized by a pyran ring fused to a xanthene core, which contributes to its unique chemical properties. It typically exhibits a range of biological activities, including potential antioxidant and anti-inflammatory effects, making it of interest in medicinal chemistry. The presence of hydroxy and methoxy functional groups enhances its solubility and reactivity, influencing its interaction with biological targets. Additionally, this compound may exhibit fluorescence properties, which can be useful in various applications, including imaging and sensing. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, 10-hydroxy-5,9-dimethoxy-2H-pyrano[2,3,4-kl]xanthen-2-one is a notable compound in the field of organic chemistry and pharmacology, warranting further investigation for its potential therapeutic applications.
Formula:C17H12O6
InChI:InChI=1/C17H12O6/c1-20-8-3-14-17-10(6-16(19)23-15(17)4-8)9-5-11(18)13(21-2)7-12(9)22-14/h3-7,18H,1-2H3
SMILES:COc1cc2c3c(cc(=O)oc3c1)c1cc(c(cc1O2)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.