CAS 112080-08-7
:2-Fluoro-6-(trifluoromethyl)quinoxaline
Description:
2-Fluoro-6-(trifluoromethyl)quinoxaline is a heterocyclic compound characterized by the presence of a quinoxaline core, which consists of two fused aromatic rings containing nitrogen atoms. The compound features a fluorine atom at the 2-position and a trifluoromethyl group at the 6-position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. This compound is typically used in medicinal chemistry and material science due to its potential as a building block for pharmaceuticals and agrochemicals. Its fluorinated structure may impart desirable characteristics such as increased metabolic stability and altered pharmacokinetics. Additionally, 2-Fluoro-6-(trifluoromethyl)quinoxaline may exhibit interesting electronic properties, making it a subject of study in various chemical applications. As with many fluorinated compounds, it is important to handle it with care due to potential environmental and health impacts associated with fluorinated substances.
Formula:C9H4F4N2
InChI:InChI=1S/C9H4F4N2/c10-8-4-14-7-3-5(9(11,12)13)1-2-6(7)15-8/h1-4H
InChI key:InChIKey=JJOVKYFELGCKRT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC2=C(C=C1)N=C(F)C=N2
Synonyms:- 2-Fluoro-6-(trifluoromethyl)quinoxaline
- Quinoxaline, 2-fluoro-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
