CAS 1121-13-7
:ISOXAZOLE, 4-NITRO-
Description:
4-Nitroisoxazole is a heterocyclic organic compound characterized by a five-membered ring containing both nitrogen and oxygen atoms. The structure features a nitro group (-NO2) at the 4-position of the isoxazole ring, which contributes to its chemical reactivity and properties. This compound is typically a pale yellow solid and is known for its aromatic characteristics, which can influence its solubility and stability. 4-Nitroisoxazole is often used in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its nitro group can participate in electrophilic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the isoxazole ring imparts unique electronic properties, which can be exploited in the design of materials and bioactive compounds. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards.
Formula:C3H2N2O3
InChI:InChI=1/C3H2N2O3/c6-5(7)3-1-4-8-2-3/h1-2H
SMILES:c1c(con1)N(=O)=O
Synonyms:- 4-Nitroisoxazole
- 4-Nitro-1,2-Oxazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Nitroisoxazole
CAS:4-Nitroisoxazole is a primary amino compound that has been synthesized from the reaction of nitrobenzene with ammonia. 4-Nitroisoxazole is homochiral, meaning it can exist in only one form. It has been shown to stabilize secondary and tertiary amines, which are used as building blocks for peptides, proteins, and other biomolecules. When 4-nitroisoxazole is treated with zinc powder in hydrochloric acid, an asymmetric synthesis occurs. The resulting product is an isoxazole with two different chiral centers. This process can be catalyzed by ammonium nitrate, which is a chemical reagent that can be used for industrial purposes such as fertilizer production.Formula:C3H2N2O3Purity:Min. 95%Molecular weight:114.06 g/mol



