CAS 1121-30-8
:1-hydroxyl-1H-pyridine-2-thione
Description:
1-Hydroxyl-1H-pyridine-2-thione, with the CAS number 1121-30-8, is a heterocyclic compound featuring a pyridine ring substituted with a hydroxyl group and a thione functional group. This compound is characterized by its ability to participate in various chemical reactions due to the presence of both the hydroxyl and thione functionalities, which can act as nucleophiles or ligands in coordination chemistry. It typically exhibits moderate solubility in polar solvents, reflecting the influence of the hydroxyl group on its polarity. The thione group contributes to its reactivity, particularly in forming metal complexes, which can be of interest in coordination chemistry and catalysis. Additionally, 1-hydroxyl-1H-pyridine-2-thione may display biological activity, making it relevant in medicinal chemistry and pharmacology. Its structural features allow for potential applications in various fields, including organic synthesis and materials science. Overall, this compound is notable for its unique combination of functional groups and the resulting chemical properties.
Formula:C5H5NOS
InChI:InChI=1/C5H5NOS/c7-6-4-2-1-3-5(6)8/h1-4,7H
InChI key:InChIKey=YBBJKCMMCRQZMA-UHFFFAOYSA-N
SMILES:c1ccn(c(=S)c1)O
Synonyms:- 1-Hydroxy-1,2-dihydropyridine-2-thione
- 1-Hydroxy-1H-pyridine-2-thione
- 1-Hydroxy-2-(1H)-pyridinethione
- 1-Hydroxy-2-pyridinethione
- 1-Hydroxy-2-thiopyridinone
- 1-hydroxypyridine-2(1H)-thione
- 2-(1H)-Pyridinethione, 1-hydroxy-
- Ai3-60234
- Brn 0109936
- N-Hydroxy-2-thiopyridone
- N-Hydroxypyridine-2(1H)-thione
- N-Hydroxypyridine-2-thione
- Nsc 179790
- Omadine
- Pyrithione
- Sq 2113
- Unii-6Gk82Ec25D
- 1-Hydroxyl-1H-pyridine-2-thione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyrithione
CAS:Pyrithione (1-hydroxyl-1H-pyridine-2-thione) is a transition metal complex, a zinc ionophore, that causes elevated zinc levels in mammalian cells.Formula:C5H5NOSPurity:98.37% - 99.55%Color and Shape:SolidMolecular weight:127.161-hydroxyl-1H-pyridine-2-thione
CAS:Formula:C5H5NOSPurity:96%Color and Shape:SolidMolecular weight:127.1643Ref: IN-DA008S6R
1g218.00€5gTo inquire25gTo inquire50gTo inquire100gTo inquire10mg57.00€100mg79.00€250mg131.00€500mg183.00€1-Hydroxy-2(1H)-pyridinethione
CAS:1-Hydroxy-2(1H)-pyridinethione (PYR) is a metal chelate that has been shown to bind to zinc and copper with high affinity. The pyrithione form of this compound is used in the treatment of dandruff, seborrheic dermatitis, and psoriasis. It is also used for the prevention of hair loss and as an adjuvant therapy for cancer. The coordination geometry of PYR is octahedral and its cytosolic concentration is less than 1 μM. Its acute toxicity has been studied in rats, mice, and rabbits, with no deaths occurring up to doses of 2000 mg/kg. In addition to its anti-inflammatory properties, PYR has synergistic effects on cells when combined with sodium salts such as sodium sulfate or sodium chloride.Formula:C5H5NOSPurity:Min. 95%Molecular weight:127.17 g/mol




