CAS 1121-79-5
:3-Chloro-6-methyl pyridazine
Description:
3-Chloro-6-methylpyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which consists of two adjacent nitrogen atoms in a six-membered aromatic ring. The presence of a chlorine atom at the 3-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The chlorine substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the methyl group can influence the compound's solubility and stability. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3-chloro-6-methylpyridazine is a valuable compound in synthetic chemistry, with properties that warrant further exploration in various applications.
Formula:C5H5ClN2
InChI:InChI=1/C5H5ClN2/c1-4-2-3-5(6)8-7-4/h2-3H,1H3
Synonyms:- Pyridazine, 3-chloro-6-methyl-
- 3-Chloro-6-Methylpyridazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Chloro-6-methylpyridazine
CAS:Formula:C5H5ClN2Purity:95%Color and Shape:SolidMolecular weight:128.55963-Chloro-6-methylpyridazine
CAS:3-Chloro-6-methylpyridazineFormula:C5H5ClN2Purity:98%Color and Shape: light yellow solidMolecular weight:128.56g/mol3-Chloro-6-methylpyridazine
CAS:Formula:C5H5ClN2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:128.563-Chloro-6-methylpyridazine
CAS:Formula:C5H5ClN2Purity:95%Color and Shape:SolidMolecular weight:128.563-Chloro-6-methylpyridazine
CAS:Controlled Product<p>Applications 3-Chloro-6-methylpyridazine is used for preparation of heterocyclic compounds as integrase inhibiting antiviral agents.<br>References Betail, G., et al.: Ann. Pharm. Fr., 36, 317 (1978), Elben, U., et al.: J. Chem. Res., 316 (1978),<br></p>Formula:C5H5ClN2Color and Shape:NeatMolecular weight:128.56





