CAS 1121-96-6
:1,2-Dithiolane-4,4-dimethanol
Description:
1,2-Dithiolane-4,4-dimethanol is a cyclic organic compound characterized by a five-membered ring containing two sulfur atoms and two hydroxymethyl groups. Its molecular structure features a dithiolane ring, which contributes to its unique chemical properties, including its ability to participate in redox reactions due to the presence of sulfur atoms. The hydroxymethyl groups enhance its solubility in polar solvents and provide sites for potential chemical modifications. This compound is often studied for its potential applications in organic synthesis and as a building block in the development of various chemical products. Additionally, the presence of sulfur in its structure may impart interesting electronic properties, making it a subject of interest in materials science and medicinal chemistry. Safety data indicates that, like many sulfur-containing compounds, it should be handled with care, as it may pose risks of irritation or toxicity under certain conditions. Overall, 1,2-Dithiolane-4,4-dimethanol is a versatile compound with significant implications in both research and industrial applications.
Formula:C5H10O2S2
InChI:InChI=1S/C5H10O2S2/c6-1-5(2-7)3-8-9-4-5/h6-7H,1-4H2
InChI key:InChIKey=GEHRODWKNCVVJO-UHFFFAOYSA-N
SMILES:C(O)C1(CO)CSSC1
Synonyms:- 1,2-Dithiolane-4,4-dimethanol
- (1,2-Dithiolane-4,4-diyl)dimethanol
- [4-(Hydroxymethyl)-1,2-dithiolan-4-yl]methanol
- NSC 72270
- 1,2-Dithiolane-4,4-diyldimethanol
- 1,2-dithiolane-4,4-dimethanol
- 4,4-Bis(hydroxymethyl)-1,2-dithiolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1,2-Dithiolane-4,4-diyl)dimethanol
CAS:Controlled ProductFormula:C5H10O2S2Color and Shape:NeatMolecular weight:166.262
