CAS 112101-74-3

N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide

Description:

N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide, with the CAS number 112101-74-3, is a chemical compound characterized by its specific structural features, including a sulfonamide group and an acetamide moiety. This compound typically exhibits properties associated with both sulfonamides and amides, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of functional groups. The methoxy group contributes to its hydrophobic character, while the sulfonamide group may enhance its biological activity, making it of interest in medicinal chemistry. The stereochemistry indicated by the (2R) configuration suggests that it may exhibit chiral properties, which can influence its pharmacological effects. Overall, this compound may be studied for its potential therapeutic applications, particularly in the context of drug design and development, where its unique functional groups could interact with biological targets.

Formula: C₁₂H₁₈N₂O₄S

InChI: InChI=1/C12H18N2O4S/c1-8(14-9(2)15)6-10-4-5-11(18-3)12(7-10)19(13,16)17/h4-5,7-8H,6H2,1-3H3,(H,14,15)(H2,13,16,17)/t8-/m1/s1

SMILES: C[C@H](Cc1ccc(c(c1)S(=O)(=O)N)OC)N=C(C)O

Synonyms:

• Acetamide, N-[(1R)-2-[3-(aminosulfonyl)-4-methoxyphenyl]-1-methylethyl]-

N-[(1R)-2-[3-(Aminosulfonyl)-4-Methoxyphenyl]-1-Methylethyl]-Acetamide

CAS: 112101-74-3

N-[(1R)-2-[3-(Aminosulfonyl)-4-Methoxyphenyl]-1-Methylethyl]-Acetamide

Purity: 98%

Molecular weight: 286.35g/mol

Ref: 54-OR1027520