CymitQuimica logo

CAS 112106-16-8

:

(R)-2-(2-(Tert-Butoxy)-2-Oxoethyl)Pentanoic Acid

Description:
(R)-2-(2-(Tert-Butoxy)-2-Oxoethyl)Pentanoic Acid, with the CAS number 112106-16-8, is a chiral compound that belongs to the class of carboxylic acids. It features a pentanoic acid backbone, which is a five-carbon straight-chain fatty acid, and is characterized by the presence of a tert-butoxy group and a keto functional group at the second position. The presence of the tert-butoxy group contributes to its steric bulk, influencing its reactivity and solubility properties. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its chirality indicates that it exists in two enantiomeric forms, with the (R) configuration being one of them, which can have significant implications for its biological activity and interactions. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific structure and functional groups, making it important for applications in various chemical processes.
Formula:C11H20O4
InChI:InChI=1S/C11H20O4/c1-5-6-8(10(13)14)7-9(12)15-11(2,3)4/h8H,5-7H2,1-4H3,(H,13,14)/t8-/m1/s1
InChI key:FPXXLDXAXQPOIJ-MRVPVSSYSA-N
SMILES:CCC[C@H](CC(=O)OC(C)(C)C)C(=O)O
Found 6 products.