
CAS 112106-90-8
:1,2,3,4-Tetrahydro-8-quinolinemethanol
Description:
1,2,3,4-Tetrahydro-8-quinolinemethanol is an organic compound characterized by its bicyclic structure, which includes a quinoline moiety and a tetrahydro configuration. This compound features a hydroxymethyl group (-CH2OH) attached to the quinoline ring, contributing to its potential reactivity and solubility in polar solvents. It is typically a white to off-white solid at room temperature and may exhibit moderate stability under standard conditions. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, influencing its solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its structural similarity to various bioactive molecules, potentially leading to pharmacological applications. Additionally, its synthesis and characterization are relevant in the context of developing new therapeutic agents. As with many organic compounds, handling should be done with care, considering safety protocols to mitigate any risks associated with its use.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c12-7-9-4-1-3-8-5-2-6-11-10(8)9/h1,3-4,11-12H,2,5-7H2
InChI key:InChIKey=PVPIXUPBPDDOAT-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(=CC=C1)CCCN2
Synonyms:- 1,2,3,4-Tetrahydro-8-quinolinemethanol
- 1,2,3,4-Tetrahydroquinolin-8-ylmethanol
- (1,2,3,4-Tetrahydroquinolin-8-yl)methanol
- 8-Quinolinemethanol, 1,2,3,4-tetrahydro-
- 8-(Hydroxymethyl)-1,2,3,4-tetrahydroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.