
CAS 112110-08-4
:4,6-Bis(trifluoromethyl)-2-pyridinamine
Description:
4,6-Bis(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its pyridine ring substituted with two trifluoromethyl groups at the 4 and 6 positions and an amino group at the 2 position. This structure contributes to its unique properties, including high lipophilicity and potential biological activity. The presence of trifluoromethyl groups enhances the compound's stability and influences its electronic properties, making it of interest in medicinal chemistry and material science. The amino group can participate in hydrogen bonding, which may affect its solubility and reactivity. This compound is often studied for its potential applications in pharmaceuticals, particularly as a building block in the synthesis of biologically active molecules. Additionally, its fluorinated nature may impart specific characteristics such as increased metabolic stability and altered pharmacokinetics. Safety and handling precautions are essential due to the potential toxicity associated with fluorinated compounds. Overall, 4,6-Bis(trifluoromethyl)-2-pyridinamine represents a versatile structure with significant implications in various chemical research fields.
Formula:C7H4F6N2
InChI:InChI=1S/C7H4F6N2/c8-6(9,10)3-1-4(7(11,12)13)15-5(14)2-3/h1-2H,(H2,14,15)
InChI key:InChIKey=JLFVZLNEALJLLS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C(F)(F)F)N=C(N)C1
Synonyms:- 2-Pyridinamine, 4,6-bis(trifluoromethyl)-
- 4,6-Bis(trifluoromethyl)-2-pyridinamine
- 2-Amino-4,6-bis(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.