CAS 112110-44-8: 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran
Description:6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiopyran moiety. This compound features a bromine substituent at the 6-position and two methyl groups at the 4-position, contributing to its distinct chemical properties. The presence of the thiopyran ring indicates that it contains a sulfur atom within a saturated cyclic structure, which can influence its reactivity and interactions with other chemical species. The compound is likely to exhibit moderate lipophilicity due to its hydrophobic aromatic and aliphatic components, potentially affecting its solubility in various solvents. Additionally, the bromine atom may impart specific reactivity, making it a candidate for further chemical transformations or applications in organic synthesis. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit interesting biological activities, making them of interest in medicinal chemistry and material science.
Formula:C11H13BrS
InChI:InChI=1S/C11H13BrS/c1-11(2)5-6-13-10-4-3-8(12)7-9(10)11/h3-4,7H,5-6H2,1-2H3
InChI key:InChIKey=FLNJCJQFSGXLIR-UHFFFAOYSA-N
SMILES:BrC1=CC=C2SCCC(C2=C1)(C)C
- Synonyms:
- 2H-1-benzothiopyran, 6-bromo-3,4-dihydro-4,4-dimethyl-
- 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran
- 6-Bromo-4,4-dimethylthiochroman
- 6-Bromo-4,4-dimethylthiochromane
- 6-Bromo-4,4-dimethyl-3,4-dihydro-2H-thiochromene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-Bromo-4,4-dimethylthiochroman REF: IN-DA007UPHCAS: 112110-44-8 | 97% | 31.00 €~655.00 € | Wed 05 Mar 25 |
![]() | Tazarotene Impurity 1 REF: 4Z-T-769CAS: 112110-44-8 | - - - | To inquire | Thu 06 Mar 25 |
![]() | 6-Bromo-4,4-Dimethylthiochroman REF: 54-OR1011992CAS: 112110-44-8 | 0.99 | 170.00 €~594.00 € | Thu 06 Mar 25 |
![]() | 6-Bromo-4,4-dimethylthiochroman REF: 10-F230419CAS: 112110-44-8 | 95% | - - - | Discontinued product |
![]() | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran REF: 3D-FB45903CAS: 112110-44-8 | Min. 95% | - - - | Discontinued product |

6-Bromo-4,4-dimethylthiochroman
Ref: IN-DA007UPH
1g | 49.00 € | ||
5g | 146.00 € | ||
25g | 655.00 € | ||
100mg | 31.00 € | ||
250mg | 32.00 € |

Tazarotene Impurity 1
Ref: 4Z-T-769
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Ref: 10-F230419
1g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran
Ref: 3D-FB45903
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |