CAS 112111-44-1
:(S)-(+)-Modafinic acid
Description:
(S)-(+)-Modafinic acid, with the CAS number 112111-44-1, is a chiral compound derived from modafinil, a wakefulness-promoting agent. This substance is characterized by its specific stereochemistry, which contributes to its biological activity. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and methanol, but less soluble in non-polar solvents. The compound exhibits a moderate melting point and has a relatively stable structure under standard conditions. Its pharmacological properties are linked to its ability to enhance cognitive function and alertness, making it of interest in both medical and research contexts. The presence of a carboxylic acid functional group in its structure is significant for its reactivity and potential interactions with biological systems. As a chiral molecule, it may exhibit different biological activities compared to its enantiomer, highlighting the importance of stereochemistry in drug design and efficacy. Overall, (S)-(+)-Modafinic acid represents a notable compound in the study of cognitive enhancers and related therapeutic applications.
Formula:C15H14O3S
InChI:InChI=1S/C15H14O3S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,16,17)/t19-/m0/s1
InChI key:InChIKey=QARQPIWTMBRJFX-IBGZPJMESA-N
SMILES:C(S(CC(O)=O)=O)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- 2-[(S)-(Diphenylmethyl)sulfinyl]acetic acid
- (S)-2-(Benzhydrylsulfinyl)acetic acid
- (S)-(+)-Modafinic acid
- Acetic acid, 2-[(S)-(diphenylmethyl)sulfinyl]-
- Acetic acid, [(S)-(diphenylmethyl)sulfinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(S)-Modafinil EP Impurity A-d5 ((S)-Modafinil Acid-d5)
CAS:Formula:C15H6D5O3SColor and Shape:White To Off-White SolidMolecular weight:279.36(S)-(+)-Modafinil Acid
CAS:Formula:C15H16O3SColor and Shape:White To Off-White SolidMolecular weight:274.34(S)-(+)-Modafinic Acid
CAS:Applications (S)-(+)-Modafinic Acid is an intermediate in the synthesis of Modafinil (M482500) related compounds with neuroprotective properties.
References Ternois, J., et al.: Org. Proc. Res. Develop., 12, 614 (2008); Prisinzano, T., et al.: Tetrahedron. Asym., 15, 1053 (2004);Formula:C15H14O3SColor and Shape:NeatMolecular weight:274.33


