CAS 112147-27-0
:2,6-DIBROMOINDOSALICYLIC ACID DISODIUM SALT
Description:
2,6-Dibromoindosalicylic acid disodium salt is a chemical compound characterized by its unique structure, which includes both bromine substituents and a salicylic acid moiety. This compound typically appears as a white to off-white crystalline solid, soluble in water due to the presence of sodium ions, which enhances its solubility compared to its acid form. It exhibits properties associated with both the indole and salicylic acid functional groups, potentially contributing to its biological activity. The presence of bromine atoms may impart additional reactivity and influence its interaction with biological systems. This compound is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in relation to its role as a reagent or in the synthesis of other chemical entities. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C13H5Br2NNa2O4
InChI:InChI=1/C13H7Br2NO4.2Na/c14-9-4-7(5-10(15)12(9)18)16-6-1-2-11(17)8(3-6)13(19)20;;/h1-5,17H,(H,19,20);;/q;2*+1/p-2
SMILES:c1cc(c(cc1N=C1C=C(C(=O)C(=C1)Br)Br)C(=O)O)O.[Na].[Na]
Synonyms:- 2,6-Dibromophenolindosalicylic Acid Disodium Salt
- Disodium 2,6-Dibromobenzenone-Indo-3'-Carboxyphenol
- 2,6-Dibromoindosalicylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
