CymitQuimica logo

CAS 1121529-18-7

:

3,5-Dimethyl-4-(2-thienyl)isoxazole

Description:
3,5-Dimethyl-4-(2-thienyl)isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of two methyl groups at the 3 and 5 positions of the isoxazole ring contributes to its hydrophobic characteristics, while the thienyl group at the 4 position introduces a sulfur-containing heterocycle, enhancing its potential for various chemical interactions. This compound is typically studied for its biological activity, particularly in medicinal chemistry, where modifications to the isoxazole structure can influence pharmacological properties. Its unique structural features may impart specific reactivity and solubility characteristics, making it of interest in the development of pharmaceuticals or agrochemicals. Additionally, the compound's stability, melting point, and solubility in various solvents can vary based on its molecular interactions and the presence of functional groups. Overall, 3,5-Dimethyl-4-(2-thienyl)isoxazole represents a versatile scaffold for further chemical exploration and application in various fields.
Formula:C9H9NOS
InChI:InChI=1S/C9H9NOS/c1-6-9(7(2)11-10-6)8-4-3-5-12-8/h3-5H,1-2H3
InChI key:InChIKey=GYZMBLNTDOUHKG-UHFFFAOYSA-N
SMILES:CC=1C(=C(C)ON1)C2=CC=CS2
Synonyms:
  • 3,5-Dimethyl-4-(thiophen-2-yl)-1,2-oxazole
  • 3,5-Dimethyl-4-(2-thienyl)isoxazole
  • 3,5-Dimethyl-4-(thiophen-2-yl)isoxazole
  • Isoxazole, 3,5-dimethyl-4-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.