CAS 1121583-64-9
:3,4-Dihydro-7-(trifluoromethyl)-2H-1-benzopyran-4-acetic acid
Description:
3,4-Dihydro-7-(trifluoromethyl)-2H-1-benzopyran-4-acetic acid is a chemical compound characterized by its unique structural features, which include a benzopyran core and a trifluoromethyl group. This compound belongs to the class of benzopyrans, which are known for their diverse biological activities. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its pharmacological properties. The acetic acid moiety contributes to its acidity and potential reactivity. This compound may exhibit various interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its biological activity and potential applications in pharmaceuticals or other fields.
Formula:C12H11F3O3
InChI:InChI=1S/C12H11F3O3/c13-12(14,15)8-1-2-9-7(5-11(16)17)3-4-18-10(9)6-8/h1-2,6-7H,3-5H2,(H,16,17)
InChI key:InChIKey=WUQVTWDPKYDLGG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C=2C(=CC(C(F)(F)F)=CC2)OCC1
Synonyms:- 2H-1-Benzopyran-4-acetic acid, 3,4-dihydro-7-(trifluoromethyl)-
- 3,4-Dihydro-7-(trifluoromethyl)-2H-1-benzopyran-4-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
