CAS 1121586-29-5

Benzoic acid, 4-fluoro-3-iodo-, methyl ester

Description:

Benzoic acid, 4-fluoro-3-iodo-, methyl ester is an organic compound characterized by the presence of a benzoic acid moiety with specific halogen substitutions. The compound features a methyl ester functional group, which indicates that it is an ester formed from benzoic acid and methanol. The presence of a fluorine atom at the para position and an iodine atom at the meta position relative to the carboxylic acid group influences its chemical reactivity and physical properties, such as solubility and boiling point. Generally, halogenated compounds can exhibit altered electronic properties, which may affect their interactions in biological systems and their potential applications in pharmaceuticals or agrochemicals. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and esterification processes. Additionally, the compound's unique halogen substitutions may impart specific characteristics, such as increased lipophilicity or altered metabolic pathways, making it of interest in medicinal chemistry and material science.

Formula: C₈H₆FIO₂

InChI: InChI=1S/C8H6FIO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3

InChI key: InChIKey=VVVNAJAWYUURAO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(I)=C(F)C=C1

Synonyms:

• 4-Fluoro-3-Iodo-Benzoic Acid Methyl Ester
• Benzoic acid, 4-fluoro-3-iodo-, methyl ester
• Methyl 3-iodo-4-fluorobenzoate
• Methyl 4-fluoro-3-iodobenzoate

Methyl 4-fluoro-3-iodobenzoate

CAS: 1121586-29-5

Formula: C₈H₆FIO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.0349

Ref: IN-DA007C55

Methyl 4-fluoro-3-iodobenzoate

CAS: 1121586-29-5

Methyl 4-fluoro-3-iodobenzoate

Formula: C₈H₆FIO₂

Purity: 97%

Color and Shape: faint lemon crystals

Molecular weight: 280.03g/mol

Ref: 54-PC51092

Methyl 4-fluoro-3-iodobenzoate

CAS: 1121586-29-5

Formula: C₈H₆FIO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.037

Ref: 10-F050245