CAS 112161-61-2
:3-Thiophenesulfonylchloride,2,5-dihydro-,1,1-dioxide(9CI)
Description:
3-Thiophenesulfonylchloride, 2,5-dihydro-, 1,1-dioxide, commonly referred to by its CAS number 112161-61-2, is a chemical compound characterized by its sulfonyl chloride functional group attached to a thiophene ring. This compound features a five-membered aromatic ring containing sulfur, which contributes to its unique reactivity and properties. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. Additionally, the 1,1-dioxide structure suggests that it has two oxygen atoms double-bonded to the sulfur atom, enhancing its electrophilic character. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Due to its reactive nature, it should be handled with care, as it can be corrosive and may pose hazards upon contact with moisture or reactive substances. Overall, 3-Thiophenesulfonylchloride is valuable in the synthesis of pharmaceuticals and agrochemicals.
Formula:C4H5ClO4S2
InChI:InChI=1/C4H5ClO4S2/c5-11(8,9)4-1-2-10(6,7)3-4/h1H,2-3H2
SMILES:C1=C(CS(=O)(=O)C1)S(=O)(=O)Cl
Synonyms:- 3-Thiophenesulfonyl Chloride, 2,5-Dihydro-, 1,1-Dioxide
- 2,5-Dihydrothiophene-3-Sulfonyl Chloride 1,1-Dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,5-Dihydro-1,1-dioxo-1H-thiophene-3-sulphonyl chloride
CAS:2,5-Dihydro-1,1-dioxo-1H-thiophene-3-sulphonyl chloridePurity:≥95%Color and Shape:SolidMolecular weight:216.66g/mol2,5-Dihydrothiophene-3-sulfonyl chloride 1,1-dioxide
CAS:2,5-Dihydrothiophene-3-sulfonyl chloride 1,1-dioxide is a fine chemical that is used as a versatile building block. It can be used as a reaction component or to synthesize complex compounds. 2,5-Dihydrothiophene-3-sulfonyl chloride 1,1-dioxide has CAS No. 112161-61-2 and is 100% pure with high quality.Formula:C4H5ClO4S2Purity:Min. 95%Molecular weight:216.67 g/mol


