
CAS 1121610-09-0
:1-(4-Fluoro-3-nitrophenyl)piperazine
Description:
1-(4-Fluoro-3-nitrophenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-fluoro-3-nitrophenyl group indicates that the compound has both a fluorine atom and a nitro group attached to a phenyl ring, which can significantly influence its chemical reactivity and biological activity. This compound is typically classified as an aromatic amine due to the presence of the phenyl group and is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The fluorine atom can enhance lipophilicity and metabolic stability, while the nitro group may contribute to its pharmacological properties. Additionally, the compound's structure suggests potential interactions with biological targets, making it of interest in research related to neuropharmacology and other therapeutic areas. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C10H12FN3O2
InChI:InChI=1S/C10H12FN3O2/c11-9-2-1-8(7-10(9)14(15)16)13-5-3-12-4-6-13/h1-2,7,12H,3-6H2
InChI key:InChIKey=IZPSOOWRYRIJNE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1F)N2CCNCC2
Synonyms:- 1-(4-Fluoro-3-nitrophenyl)piperazine
- Piperazine, 1-(4-fluoro-3-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.