
CAS 1121610-28-3
:1-(4-Methoxy-3-methylphenyl)piperazine
Description:
1-(4-Methoxy-3-methylphenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methoxy group and a methyl-substituted phenyl group, contributing to its unique properties. It is typically classified as an organic compound and may exhibit biological activity, making it of interest in medicinal chemistry. The presence of the methoxy group can influence its solubility and reactivity, while the piperazine moiety is often associated with various pharmacological effects, including potential anxiolytic and antidepressant properties. The compound's structure suggests it may interact with neurotransmitter systems, particularly those involving serotonin and dopamine. Its molecular interactions and potential applications in drug development are subjects of ongoing research. As with many piperazine derivatives, safety and toxicity profiles are essential considerations in its use, necessitating thorough evaluation in both laboratory and clinical settings.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-10-9-11(3-4-12(10)15-2)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
InChI key:InChIKey=PMZXESGFAZJQBR-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1OC)N2CCNCC2
Synonyms:- 1-(4-Methoxy-3-methylphenyl)piperazine
- Piperazine, 1-(4-methoxy-3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.