CAS 112190-24-6
:(2R,3R,4R,5S)-6-cyclohexyl-3,4-dihydroxy-5-{[(2S)-3-(1H-imidazol-5-yl)-2-{[(naphthalen-1-yloxy)acetyl]amino}propanoyl]amino}-2-(1-methylethyl)-N-{(1S,2S)-2-methyl-1-[(pyridin-2-ylmethyl)carbamoyl]butyl}hexanamide (non-preferred name)
Description:
The chemical substance with the name "(2R,3R,4R,5S)-6-cyclohexyl-3,4-dihydroxy-5-{[(2S)-3-(1H-imidazol-5-yl)-2-{[(naphthalen-1-yloxy)acetyl]amino}propanoyl]amino}-2-(1-methylethyl)-N-{(1S,2S)-2-methyl-1-[(pyridin-2-ylmethyl)carbamoyl]butyl}hexanamide" and CAS number "112190-24-6" is a complex organic molecule characterized by multiple functional groups and stereocenters. It features a cyclohexyl group, indicating a cyclic hydrocarbon structure, and contains hydroxyl groups, which suggest potential for hydrogen bonding and solubility in polar solvents. The presence of an imidazole ring and a naphthalenyl moiety indicates biological activity, possibly related to pharmacological properties. The molecule's stereochemistry, denoted by the specific R and S configurations, is crucial for its interaction with biological targets, influencing its efficacy and safety profile. Additionally, the presence of amide linkages suggests stability and potential for forming secondary structures in biological systems. Overall, this compound's intricate structure and diverse functional groups position it as a candidate for further investigation in medicinal chemistry.
Formula:C45H61N7O7
InChI:InChI=1/C45H61N7O7/c1-5-29(4)40(45(58)48-25-32-18-11-12-21-47-32)52-44(57)39(28(2)3)42(55)41(54)35(22-30-14-7-6-8-15-30)51-43(56)36(23-33-24-46-27-49-33)50-38(53)26-59-37-20-13-17-31-16-9-10-19-34(31)37/h9-13,16-21,24,27-30,35-36,39-42,54-55H,5-8,14-15,22-23,25-26H2,1-4H3,(H,46,49)(H,48,58)(H,50,53)(H,51,56)(H,52,57)/t29-,35-,36-,39+,40-,41+,42+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
U 75875
CAS:Controlled Product<p>Applications U 75875, is a peptidomimetic inhibitor, that inhibits HIV-1 gag-pol protein. In human peripheral blood mononuclear cells and in a continuous cell line, U-75875 completely blocked HIV replication, so it can be used as therapeutic potential of protease inhibitors for treatment of HIV infection.<br>References Ashorn, P., et al.: Proceedings of the National Academy of Sciences of the United States of America, 87, 7472 (1990);<br></p>Formula:C45H61N7O7Color and Shape:NeatMolecular weight:812.009U 75875
CAS:<p>U 75875 is a research tool that belongs to the group of ligands and activators. It binds to a receptor and activates it. U 75875 has been shown to be an inhibitor that is able to block ion channels. It may also be used in cancer therapy, as it can inhibit the growth of cancer cells by binding to the receptor tyrosine kinase.</p>Formula:C45H61N7O7Purity:Min. 95%Molecular weight:812.00 g/molU 75875
CAS:U 75875 is a protease inhibitor.Formula:C45H61N7O7Color and Shape:SolidMolecular weight:812.01


