CymitQuimica logo

CAS 112193-77-8

:

1,4,7,10-Tetraazacyclododecane, sulfate (1:2)

Description:
1,4,7,10-Tetraazacyclododecane, sulfate (1:2), commonly referred to as cyclen sulfate, is a cyclic polyamine characterized by a twelve-membered ring containing four nitrogen atoms. This compound exhibits a high degree of solubility in water due to the presence of the sulfate groups, which enhance its ionic character. The tetraazacyclododecane structure allows for the formation of stable complexes with various metal ions, making it of interest in coordination chemistry and potential applications in fields such as medicine and materials science. The sulfate moiety contributes to its overall charge and can influence its interaction with biological systems, potentially enhancing its utility in drug delivery or as a contrast agent in imaging. Additionally, the compound's stability and ability to form chelates with transition metals make it a valuable ligand in coordination chemistry. Its unique structural features and properties position it as a versatile compound in both research and practical applications.
Formula:C8H20N4·2H2O4S
InChI:InChI=1S/C8H20N4.H2O4S/c1-2-10-5-6-12-8-7-11-4-3-9-1;1-5(2,3)4/h9-12H,1-8H2;(H2,1,2,3,4)
InChI key:InChIKey=VKWLPPSMIINPDP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.C1CNCCNCCNCCN1
Synonyms:
  • 1,4,7,10-Tetraazacyclododecane, sulfate (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.