CAS 112193-83-6
:1-Benzyl-1,4,7,10-tetraazacyclododecane
Description:
1-Benzyl-1,4,7,10-tetraazacyclododecane, also known as benzylated cyclododecane, is a macrocyclic compound characterized by its unique structure that includes a twelve-membered ring containing four nitrogen atoms and eight carbon atoms. This compound exhibits a high degree of flexibility due to its cyclic nature, which allows it to adopt various conformations. The presence of the benzyl group enhances its lipophilicity, making it more soluble in organic solvents compared to its non-benzylated counterparts. It is known for its potential applications in coordination chemistry, particularly as a ligand in metal complexation, due to the availability of nitrogen donor sites. Additionally, its structural features may contribute to interesting biological activities, although specific biological properties can vary. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the surrounding environment, such as pH and temperature. Overall, 1-benzyl-1,4,7,10-tetraazacyclododecane is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C15H26N4
InChI:InChI=1/C15H26N4/c1-2-4-15(5-3-1)14-19-12-10-17-8-6-16-7-9-18-11-13-19/h1-5,16-18H,6-14H2
SMILES:c1ccc(cc1)CN1CCNCCNCCNCC1
Synonyms:- N-Benzyl-1,4,7,10-tetraazacyclododecane, min. 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzyl-1,4,7,10-tetraazacyclododecane
CAS:<p>Used as ligands for catalysts. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the</p>Formula:C15H26N4Color and Shape:White, PowderMolecular weight:262.401-Benzyl-1,4,7,10-tetraazacyclododecane
CAS:Formula:C15H26N4Purity:98%Color and Shape:SolidMolecular weight:262.3937N-Benzyl-1,4,7,10-tetraazacyclododecane, min. 98%
CAS:<p>N-Benzyl-1,4,7,10-tetraazacyclododecane, min. 98%</p>Formula:C15H26N4Purity:min. 98%Color and Shape:white to yellow pwdr.Molecular weight:262.39



