CAS 112196-57-3
:methyl N-(tert-butoxycarbonyl)-O-[tert-butyl(dimethyl)silyl]-L-tyrosinate
Description:
Methyl N-(tert-butoxycarbonyl)-O-[tert-butyl(dimethyl)silyl]-L-tyrosinate is a synthetic organic compound primarily used in peptide synthesis and as a protecting group in organic chemistry. This compound features a methyl ester functional group, which enhances its solubility and reactivity. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amine functionality, allowing for selective reactions without interfering with other functional groups. The presence of the tert-butyl(dimethyl)silyl group provides additional protection for the hydroxyl group of tyrosine, enhancing stability and facilitating further chemical transformations. The compound is typically characterized by its molecular weight, solubility in organic solvents, and stability under various conditions. Its structure allows for the selective deprotection of functional groups, making it valuable in the synthesis of complex molecules, particularly in the field of medicinal chemistry and drug development. As with many synthetic compounds, handling should be done with care, following appropriate safety protocols due to potential reactivity and toxicity.
Formula:C21H35NO5Si
InChI:InChI=1/C21H35NO5Si/c1-20(2,3)26-19(24)22-17(18(23)25-7)14-15-10-12-16(13-11-15)27-28(8,9)21(4,5)6/h10-13,17H,14H2,1-9H3,(H,22,24)/t17-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccc(cc1)O[Si](C)(C)C(C)(C)C)C(=O)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
