CymitQuimica logo

CAS 112196-58-4

:

methyl N-(tert-butoxycarbonyl)-O-[tert-butyl(dimethyl)silyl]-N-methyl-L-tyrosinate

Description:
Methyl N-(tert-butoxycarbonyl)-O-[tert-butyl(dimethyl)silyl]-N-methyl-L-tyrosinate is a synthetic organic compound characterized by its complex structure, which includes a methyl ester, a tert-butoxycarbonyl (Boc) protecting group, and a tert-butyl(dimethyl)silyl (TBS) group. This compound is typically used in peptide synthesis and organic chemistry as a protecting group for amino acids, particularly in the context of solid-phase peptide synthesis. The presence of the Boc group allows for selective deprotection under mild acidic conditions, while the TBS group provides stability against nucleophilic attack and can be removed under fluoride conditions. The compound is generally soluble in organic solvents such as dichloromethane and dimethylformamide, making it suitable for various synthetic applications. Its molecular structure contributes to its reactivity and stability, making it a valuable intermediate in the synthesis of more complex molecules, particularly in pharmaceutical and biochemical research. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C22H37NO5Si
InChI:InChI=1/C22H37NO5Si/c1-21(2,3)27-20(25)23(7)18(19(24)26-8)15-16-11-13-17(14-12-16)28-29(9,10)22(4,5)6/h11-14,18H,15H2,1-10H3/t18-/m0/s1
SMILES:CC(C)(C)OC(=O)N(C)[C@@H](Cc1ccc(cc1)O[Si](C)(C)C(C)(C)C)C(=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.