CAS 112197-15-6: 3-Iodo-2-methoxypyridine
Description:3-Iodo-2-methoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an iodine atom and a methoxy group. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The iodine substituent typically enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group, being an electron-donating group, can influence the electronic distribution within the molecule, affecting its reactivity and solubility. This compound is often utilized in medicinal chemistry and organic synthesis, serving as an intermediate in the preparation of more complex molecules. Its unique combination of functional groups allows for diverse applications in pharmaceuticals and agrochemicals. Additionally, the presence of the iodine atom can facilitate further functionalization, making it a valuable building block in synthetic chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling 3-Iodo-2-methoxypyridine due to potential toxicity and environmental concerns.
Formula:C6H6INO
InChI:InChI=1S/C6H6INO/c1-9-6-5(7)3-2-4-8-6/h2-4H,1H3
InChI key:InChIKey=BXCHJERCAUZLOE-UHFFFAOYSA-N
SMILES:IC1=CC=CN=C1OC
- Synonyms:
- 2-Methoxy-3-Iodopyridine
- 3-Iodo-2-Methoxy-Pyridine
- 3-Iodo-2-Methoxypyridine 99%
- Pyridine, 3-iodo-2-methoxy-
- 3-Iodo-2-methoxypyridine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Iodo-2-methoxypyridine REF: IN-DA003JL8CAS: 112197-15-6 | 98% | 23.00 €~172.00 € | Fri 28 Mar 25 |
 | 3-Iodo-2-methoxypyridine REF: 3B-I0924CAS: 112197-15-6 | >98.0%(GC)(T) | 50.00 €~151.00 € | Mon 31 Mar 25 |
 | 3-Iodo-2-methoxypyridine REF: 54-OR345009CAS: 112197-15-6 | 98+% | 32.00 €~1,150.00 € | Fri 04 Apr 25 |
 | 3-Iodo-2-methoxypyridine REF: 10-F036267CAS: 112197-15-6 | 95.0% | To inquire | Mon 07 Apr 25 |
 | 3-Iodo-2-methoxypyridine REF: 3D-FI50796CAS: 112197-15-6 | Min. 95% | - - - | Discontinued product |
3-Iodo-2-methoxypyridine
Ref: IN-DA003JL8
| 1g | 23.00 € | ||
| 5g | 32.00 € | ||
| 10g | 53.00 € | ||
| 25g | 77.00 € | ||
| 100g | 172.00 € |
3-Iodo-2-methoxypyridine
Ref: 3B-I0924
| 1g | 50.00 € | ||
| 5g | 151.00 € |
Ref: 54-OR345009
| 5g | 32.00 € | ||
| 25g | 76.00 € | ||
| 100g | 258.00 € | ||
| 500g | 1,150.00 € |
3-Iodo-2-methoxypyridine
Ref: 10-F036267
| 5g | To inquire | ||
| 10g | 32.00 € | ||
| 25g | 62.00 € | ||
| 100g | 219.00 € | ||
| 500g | To inquire |
3-Iodo-2-methoxypyridine
Ref: 3D-FI50796
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information |
