
CAS 112197-89-4
:3-Hydroxy-1-(phenylmethyl)-3-piperidinemethanol
Description:
3-Hydroxy-1-(phenylmethyl)-3-piperidinemethanol, with the CAS number 112197-89-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a hydroxyl group (-OH) and a phenylmethyl group (benzyl group) attached to the piperidine, contributing to its potential biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The phenylmethyl moiety can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or referenced from chemical databases for practical applications.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c15-11-13(16)7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,15-16H,4,7-11H2
InChI key:InChIKey=XOFDNFCDAYQIEF-UHFFFAOYSA-N
SMILES:C(N1CC(CO)(O)CCC1)C2=CC=CC=C2
Synonyms:- N-Benzyl-3-hydroxymethylpiperidin-3-ol
- 1-Benzyl-3-(hydroxymethyl)piperidin-3-ol
- 3-Hydroxy-3-(hydroxymethyl)-1-(phenylmethyl)piperidine
- 3-Piperidinemethanol, 3-hydroxy-1-(phenylmethyl)-
- 3-Hydroxy-1-(phenylmethyl)-3-piperidinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.