CAS 1122-20-9
:2,3-Dimethyl-2-cyclohexen-1-one
Description:
2,3-Dimethyl-2-cyclohexen-1-one is an organic compound characterized by its cyclic structure and the presence of a ketone functional group. It features a cyclohexene ring with two methyl groups attached at the 2 and 3 positions, contributing to its unique reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its unsaturated nature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. The presence of the double bond in the cyclohexene ring makes it susceptible to electrophilic addition reactions, while the ketone group can participate in nucleophilic addition reactions. 2,3-Dimethyl-2-cyclohexen-1-one is of interest in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Its reactivity and structural features make it a valuable compound in the field of organic chemistry, particularly in the synthesis of more complex molecules.
Formula:C8H12O
InChI:InChI=1S/C8H12O/c1-6-4-3-5-8(9)7(6)2/h3-5H2,1-2H3
InChI key:InChIKey=FRJKTQQNQDTORT-UHFFFAOYSA-N
SMILES:CC1=C(C)CCCC1=O
Synonyms:- 2,3-Dimethylcyclohexenone
- 2-Cyclohexen-1-one, 2,3-dimethyl-
- 2,3-Dimethylcyclohex-2-enone
- 2,3-Dimethyl-2-cyclohexen-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,3-Dimethylcyclohex-2-en-1-one
CAS:2,3-Dimethylcyclohex-2-en-1-one is a phenylhydrazine derivative that can be converted into aporphine alkaloids. It is also an isomer of cyclohexenones and epoxides. This compound has substituents at the 2 and 3 positions which are either methyl or hydrogen, respectively. The carbonyl group in 2,3-Dimethylcyclohex-2-en-1-one is a ketone or aldehyde, depending on the substitution pattern. The oxygen function in this molecule is an ether or ester. 2,3-Dimethylcyclohex-2-en-1-one has properties that are similar to those of diketones and spirolactones because it contains both carbonyl and oxygen functions. It can be classified as an aporphine alkaloid because it has two rings fused together with one nitrogen atom between them
Formula:C8H12OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:124.18 g/mol
