CAS 1122-26-5

Cyclohexanone, 2-methyl-, oxime

Description:

Cyclohexanone, 2-methyl-, oxime, with the CAS number 1122-26-5, is an organic compound characterized by the presence of a cyclohexanone ring substituted with a methyl group and an oxime functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits limited solubility in water. The oxime functional group, which is characterized by the presence of a nitrogen atom double-bonded to an oxygen atom and single-bonded to a carbon atom, imparts specific reactivity, making it useful in various chemical reactions, including condensation and rearrangement reactions. Cyclohexanone oxime is often utilized in the synthesis of other organic compounds and can serve as an intermediate in the production of certain pharmaceuticals and agrochemicals. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use. Overall, its unique structure and properties make it a valuable compound in organic chemistry and industrial applications.

Formula: C₇H₁₃NO

InChI: InChI=1S/C7H13NO/c1-6-4-2-3-5-7(6)8-9/h6,9H,2-5H2,1H3

InChI key: InChIKey=MDIFHVYPHRHKLB-UHFFFAOYSA-N

SMILES: N(O)=C1C(C)CCCC1

Synonyms:

• 2-Methylcyclohexanone oxime
• NSC 139569
• Cyclohexanone, 2-methyl-, oxime

2-Methylcyclohexanone oxime

CAS: 1122-26-5

Formula: C₇H₁₃NO

Purity: 98%

Molecular weight: 127.1842

Ref: IN-DA009QZV