CymitQuimica logo

CAS 1122-49-2

:

2-Bromo-2-cyclohepten-1-one

Description:
2-Bromo-2-cyclohepten-1-one, with the CAS number 1122-49-2, is an organic compound characterized by its unique bicyclic structure. It features a cycloheptene ring, which is a seven-membered carbon ring containing a double bond, and a ketone functional group at the first position, along with a bromine substituent at the second position. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of the bromine atom, which can participate in various nucleophilic substitution reactions. The ketone group contributes to its electrophilic character, making it a useful intermediate in organic synthesis. Additionally, 2-Bromo-2-cyclohepten-1-one can undergo various transformations, including cycloaddition and rearrangement reactions, which are valuable in the development of more complex organic molecules. Its properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals and materials science.
Formula:C7H9BrO
InChI:InChI=1S/C7H9BrO/c8-6-4-2-1-3-5-7(6)9/h4H,1-3,5H2
InChI key:InChIKey=KNMSHANDXYYGQT-UHFFFAOYSA-N
SMILES:BrC=1C(=O)CCCCC1
Synonyms:
  • 2-Cyclohepten-1-one, 2-bromo-
  • 2-Bromocyclohept-2-enone
  • 2-Bromo-2-cyclohepten-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.