
CAS 1122022-03-0
:4-[(5R)-5-(3,5-Dichlorophenyl)-4,5-dihydro-5-(trifluoromethyl)-3-isoxazolyl]-2-methyl-N-[2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]benzamide
Description:
The chemical substance with the name "4-[(5R)-5-(3,5-Dichlorophenyl)-4,5-dihydro-5-(trifluoromethyl)-3-isoxazolyl]-2-methyl-N-[2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]benzamide" and CAS number 1122022-03-0 is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an isoxazole ring, which contributes to its potential biological activity. The presence of trifluoromethyl and dichlorophenyl groups suggests that the compound may exhibit significant lipophilicity and possibly enhanced potency in biological systems. The benzamide moiety indicates potential interactions with biological targets, such as enzymes or receptors. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its stereochemistry, indicated by the (5R) configuration, may also play a crucial role in its biological activity and interaction with target sites. Overall, the intricate structure of this compound suggests a potential for diverse applications in medicinal chemistry and drug development.
Formula:C22H17Cl2F6N3O3
InChI:InChI=1S/C22H17Cl2F6N3O3/c1-11-4-12(2-3-16(11)19(35)31-9-18(34)32-10-21(25,26)27)17-8-20(36-33-17,22(28,29)30)13-5-14(23)7-15(24)6-13/h2-7H,8-10H2,1H3,(H,31,35)(H,32,34)/t20-/m1/s1
InChI key:InChIKey=MLBZKOGAMRTSKP-HXUWFJFHSA-N
SMILES:[C@@](F)(F)(F)[C@@]1(CC(=NO1)C2=CC(C)=C(C(NCC(NCC(F)(F)F)=O)=O)C=C2)C3=CC(Cl)=CC(Cl)=C3
Synonyms:- R-(-)-Fluralaner
- Benzamide, 4-[(5R)-5-(3,5-dichlorophenyl)-4,5-dihydro-5-(trifluoromethyl)-3-isoxazolyl]-2-methyl-N-[2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]-
- A 663
- (R)-A 1443
- 4-[(5R)-5-(3,5-Dichlorophenyl)-4,5-dihydro-5-(trifluoromethyl)-3-isoxazolyl]-2-methyl-N-[2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
