CAS 112233-25-7

1-Propene-1,1-diamine, 3-[5-[(dimethylamino)methyl]-2-furanyl]-N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-, (Z)-

Description:

1-Propene-1,1-diamine, 3-[5-[(dimethylamino)methyl]-2-furanyl]-N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-, (Z)- is a complex organic compound characterized by its multi-functional groups, including amine, nitro, and furan moieties. The presence of the furan ring suggests potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions and can exhibit pharmacological properties. The compound features a propene backbone, which may contribute to its reactivity, particularly in addition reactions. The dimethylamino groups enhance its basicity and solubility in polar solvents, while the nitro group can influence its electronic properties and reactivity. The (Z)- configuration indicates specific stereochemistry, which can affect the compound's interactions and biological activity. Overall, this substance is likely to be of interest in medicinal chemistry and materials science due to its structural complexity and potential applications. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₂₁H₃₃N₅O₄S

InChI: InChI=1S/C21H33N5O4S/c1-22-21(20(26(27)28)12-16-6-7-17(29-16)13-24(2)3)23-10-11-31-15-19-9-8-18(30-19)14-25(4)5/h6-9,22-23H,10-15H2,1-5H3/b21-20-

InChI key: InChIKey=VZXBPGNYACMAPS-MRCUWXFGSA-N

SMILES: C(/C(=C(/NCCSCC=1OC(CN(C)C)=CC1)\NC)/N(=O)=O)C=2OC(CN(C)C)=CC2

Synonyms:

• 1-Propene-1,1-diamine, 3-[5-[(dimethylamino)methyl]-2-furanyl]-N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-, (Z)-

Ranitidine Impurity 13

CAS: 112233-25-7

Formula: C₂₁H₃₃N₅O₄S

Molecular weight: 451.59

Ref: 4Z-R-0327

(Z)-3-(5-((Dimethylamino)methyl)furan-2-yl)-N-(2-(((5-((dimethylamino)methyl)furan-2-yl)methyl)thio)ethyl)-N-methyl-2-nitroprop-1-ene-1,1-diamine

Controlled Product

CAS: 112233-25-7

Applications (Z)-3-(5-((Dimethylamino)methyl)furan-2-yl)-N-(2-(((5-((dimethylamino)methyl)furan-2-yl)methyl)thio)ethyl)-N-methyl-2-nitroprop-1-ene-1,1-diamine is a degradation products of ranitidine. Ranitidine is a medication used in the treatment of stomach acid, peptic ulcer and other gastro or GIT related diseases.
References Haywood, P. A., et al.: J. Chem. Soc. Perkin Trans. I Org. Bio-Org. Chem., 951, 5 (1987)

Formula: C₂₁H₃₃N₅O₄S

Color and Shape: Neat

Molecular weight: 451.583

Ref: TR-D462492