CAS 112233-75-7

Guanosine, N-acetyl-, 2′,3′,5′-triacetate 6-(N,N-diphenylcarbamate)

Description:

Guanosine, N-acetyl-, 2′,3′,5′-triacetate 6-(N,N-diphenylcarbamate) is a modified nucleoside derivative characterized by the presence of multiple acetyl groups and a diphenylcarbamate moiety. This compound features a guanosine backbone, which is a purine nucleoside composed of a guanine base linked to a ribose sugar. The acetylation at the 2′, 3′, and 5′ positions enhances its solubility and stability, making it potentially useful in biochemical applications. The diphenylcarbamate group introduces additional hydrophobic characteristics, which may influence its interaction with biological targets. This compound may exhibit unique pharmacological properties, including potential antiviral or anticancer activities, due to its structural modifications. Its synthesis and characterization typically involve organic chemistry techniques, including acetylation reactions and carbamate formation. As with many nucleoside analogs, its biological activity and mechanism of action would be of interest in medicinal chemistry and drug development research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₃₁H₃₀N₆O₁₀

InChI: InChI=1S/C31H30N6O10/c1-17(38)33-30-34-27-24(28(35-30)47-31(42)37(21-11-7-5-8-12-21)22-13-9-6-10-14-22)32-16-36(27)29-26(45-20(4)41)25(44-19(3)40)23(46-29)15-43-18(2)39/h5-14,16,23,25-26,29H,15H2,1-4H3,(H,33,34,35,38)/t23-,25-,26-,29-/m1/s1

InChI key: InChIKey=XSSWDMURTPAIDU-CTDWIVFPSA-N

SMILES: O(C(C)=O)[C@H]1[C@@H](O[C@H](COC(C)=O)[C@H]1OC(C)=O)N2C=3C(N=C2)=C(OC(N(C4=CC=CC=C4)C5=CC=CC=C5)=O)N=C(NC(C)=O)N3

Synonyms:

• Guanosine, N-acetyl-, 2′,3′,5′-triacetate 6-(N,N-diphenylcarbamate)
• Guanosine, N-acetyl-, 2′,3′,5′-triacetate 6-(diphenylcarbamate)
• Guanosine, N-acetyl-, 2',3',5'-triacetate 6-(N,N-diphenylcarbamate)
• N-Acetyl-guanosine 2',3',5'-Triacetate 6-(N,N-Diphenylcarbamate)