CAS 1122484-78-9

9H-Fluoren-9-ylmethyl 12,12-dimethyl-10-oxo-5,8,11-trioxa-2-azatridecanoate

Description:

9H-Fluoren-9-ylmethyl 12,12-dimethyl-10-oxo-5,8,11-trioxa-2-azatridecanoate, with the CAS number 1122484-78-9, is a synthetic organic compound characterized by its complex structure, which includes a fluorenylmethyl group and a polyether segment. This compound features multiple functional groups, including esters and ketones, contributing to its potential reactivity and solubility properties. The presence of the azetidine ring suggests that it may exhibit unique biological activities, making it of interest in medicinal chemistry. Its molecular architecture may allow for interactions with various biological targets, potentially leading to applications in drug development. Additionally, the compound's stability and solubility in organic solvents can facilitate its use in various chemical reactions and formulations. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₂₅H₃₁NO₆

InChI: InChI=1S/C25H31NO6/c1-25(2,3)32-23(27)17-30-15-14-29-13-12-26-24(28)31-16-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-11,22H,12-17H2,1-3H3,(H,26,28)

InChI key: InChIKey=AALGOFOXFDCUNQ-UHFFFAOYSA-N

SMILES: C(OC(NCCOCCOCC(OC(C)(C)C)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2

Synonyms:

• 9H-Fluoren-9-ylmethyl 12,12-dimethyl-10-oxo-5,8,11-trioxa-2-azatridecanoate
• 5,8,11-Trioxa-2-azatridecanoic acid, 12,12-dimethyl-10-oxo-, 9H-fluoren-9-ylmethyl ester