CymitQuimica logo

CAS 1122549-47-6

:

3-(Chloromethyl)-N-(5-chloro-2-pyridinyl)-2-pyrazinecarboxamide

Description:
3-(Chloromethyl)-N-(5-chloro-2-pyridinyl)-2-pyrazinecarboxamide is a chemical compound characterized by its complex structure, which includes a pyrazine ring, a pyridine moiety, and a chloromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of chlorine atoms in its structure may contribute to its reactivity and influence its interactions with biological targets. The carboxamide functional group suggests that it may engage in hydrogen bonding, which can affect its solubility and stability. Such compounds are often investigated for their pharmacological properties, including antimicrobial or anticancer activities. Additionally, the specific arrangement of substituents on the rings can lead to unique electronic properties, making it of interest in medicinal chemistry and material science. Overall, this compound exemplifies the diverse chemistry of halogenated heterocycles and their potential applications in various fields.
Formula:C11H8Cl2N4O
InChI:InChI=1S/C11H8Cl2N4O/c12-5-8-10(15-4-3-14-8)11(18)17-9-2-1-7(13)6-16-9/h1-4,6H,5H2,(H,16,17,18)
InChI key:InChIKey=REKILMQTMQTBPW-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Cl)C=N1)(=O)C=2C(CCl)=NC=CN2
Synonyms:
  • 2-Pyrazinecarboxamide, 3-(chloromethyl)-N-(5-chloro-2-pyridinyl)-
  • 3-(Chloromethyl)-N-(5-chloro-2-pyridinyl)-2-pyrazinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.