
CAS 112273-62-8
:α-[(Aminocarbonyl)amino]-2-nitrobenzeneacetic acid
Description:
α-[(Aminocarbonyl)amino]-2-nitrobenzeneacetic acid, with the CAS number 112273-62-8, is a chemical compound characterized by its complex structure, which includes an amino group, a nitro group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the nitrobenzene moiety and the acetic acid component. It is likely to be a solid at room temperature and may be soluble in polar solvents, reflecting its functional groups' ability to engage in hydrogen bonding. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the aminocarbonyl group may impart specific biological activities, making this compound of interest in pharmaceutical research. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, which are crucial for applications in synthesis and biological assays. Overall, this compound represents a unique intersection of organic chemistry and potential medicinal applications.
Formula:C9H9N3O5
InChI:InChI=1S/C9H9N3O5/c10-9(15)11-7(8(13)14)5-3-1-2-4-6(5)12(16)17/h1-4,7H,(H,13,14)(H3,10,11,15)
InChI key:InChIKey=LTRMBSQYWCCNEI-UHFFFAOYSA-N
SMILES:C(NC(N)=O)(C(O)=O)C1=C(N(=O)=O)C=CC=C1
Synonyms:- α-[(Aminocarbonyl)amino]-2-nitrobenzeneacetic acid
- 2-(2-Nitrophenyl)-2-ureidoacetic acid
- Benzeneacetic acid, α-[(aminocarbonyl)amino]-2-nitro-
- Hydantoic acid, 2-(o-nitrophenyl)-
- 2-(Carbamoylamino)-2-(2-nitrophenyl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
