CAS 112281-82-0

2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propanol

Description:

2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propanol, with CAS number 112281-82-0, is a chemical compound characterized by its unique structure that includes a dichlorophenyl group and a triazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the triazole ring suggests potential antifungal or antimicrobial properties, as triazoles are known for their ability to inhibit the synthesis of ergosterol, a key component of fungal cell membranes. Additionally, the dichlorophenyl group may contribute to the compound's lipophilicity, influencing its interaction with biological systems. Overall, this compound's characteristics make it a subject of study for its potential applications in medicinal chemistry and crop protection. However, specific safety and handling guidelines should be followed due to the presence of chlorine substituents, which can pose environmental and health risks.

Formula: C₁₁H₁₁Cl₂N₃O

InChI: InChI=1S/C11H11Cl2N3O/c12-9-1-2-10(11(13)3-9)8(5-17)4-16-7-14-6-15-16/h1-3,6-8,17H,4-5H2

InChI key: InChIKey=QMUIPLNEIWEBJS-UHFFFAOYSA-N

SMILES: C(CN1C=NC=N1)(CO)C2=C(Cl)C=C(Cl)C=C2

Synonyms:

• 1H-1,2,4-Triazole-1-propanol, β-(2,4-dichlorophenyl)-
• 2-(2,4-Dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-1-ol
• β-(2,4-Dichlorophenyl)-1H-1,2,4-triazole-1-propanol
• 2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propanol
• M14360-alcohol

1H-1,2,4-Triazole-1-propanol, β-(2,4-dichlorophenyl)-

CAS: 112281-82-0

Formula: C₁₁H₁₁Cl₂N₃O

Molecular weight: 272.1305

Ref: IN-DA000VY1